CAS 31803-05-1 is the registry number for 3-Chloro-5-phenyl-4H-1,2,4-triazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-chloro-3-phenyl-1H-1,2,4-triazole (CAS 31803-05-1) is a chemical compound with the molecular formula C8H6ClN3 and a molecular weight of 179.60 g/mol. IUPAC name: 5-chloro-3-phenyl-1H-1,2,4-triazole. InChIKey: WUGMRLNXPOGSCB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3 |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 5-chloro-3-phenyl-1H-1,2,4-triazole |
| InChIKey | WUGMRLNXPOGSCB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=N2)Cl |
Computed by PubChem (NCBI)