CAS 31846-36-3 appears in our catalog under these names: 7-Hydroxy-1,2,3,4-tetrahydro-naphthalene-2-carboxylic acid, 95%, 7-Hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
7-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (CAS 31846-36-3) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 7-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid. InChIKey: DCMQTTORXXHHBL-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 7-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| InChIKey | DCMQTTORXXHHBL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1C(=O)O)C=C(C=C2)O |
Computed by PubChem (NCBI)