CAS 3190-71-4 appears in our catalog under these names: (4S)-2,5-Dioxo-4-oxazolidinepropanoic Acid Phenylmethyl Ester, (S)–Benzyl 3–(2,5–dioxooxazolidin–4–yl)propanoate, 5-Benzyl L-glutamate N-carboxyanhydride, (S)-Benzyl 3-(2,5-dioxooxazolidin-4-yl)propanoate, 97%, 97%, epsilon-Benzyl-L-glutamic acid carboxylic anhydride, 95%. Offered by: TRC, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 100g, 5g, 0,03kg, 0,01kg, 0,05kg.
Benzyl 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanoate (CAS 3190-71-4) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: benzyl 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanoate. InChIKey: UGCBVSDSTGUPBC-JTQLQIEISA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | benzyl 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanoate |
| InChIKey | UGCBVSDSTGUPBC-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CC[C@H]2C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)