Products 319493-07-7
CAS 319493-07-7 is the registry number for 6-Bromo-3-(2-nitrovinyl)-1H-indole, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-3-(2-nitroethenyl)-1H-indole (CAS 319493-07-7) is a chemical compound with the molecular formula C10H7BrN2O2 and a molecular weight of 267.08 g/mol. IUPAC name: 6-bromo-3-(2-nitroethenyl)-1H-indole. InChIKey: UVNXVMQPLCESSJ-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O2 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 6-bromo-3-(2-nitroethenyl)-1H-indole |
| InChIKey | UVNXVMQPLCESSJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC=C2C=C[N+](=O)[O-] |
Computed by PubChem (NCBI)