Products 32004-56-1
CAS 32004-56-1 appears in our catalog under these names: 3-(3,4-Difluorophenyl)-2-methylpropanoic acid, 95%, 3-(3,4-Difluorophenyl)-2-methylpropanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
3-(3,4-difluorophenyl)-2-methylpropanoic acid (CAS 32004-56-1) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 3-(3,4-difluorophenyl)-2-methylpropanoic acid. InChIKey: UBWKSHCOWRUZGP-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | 3-(3,4-difluorophenyl)-2-methylpropanoic acid |
| InChIKey | UBWKSHCOWRUZGP-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(3,4-difluorophenyl)-2-methylpropanoic acid, 3,4-Difluoro-alpha-methylbenzenepropanoic acid, UBWKSHCOWRUZGP-UHFFFAOYSA-N, 3,4-difluoro-alphamethylhydrocinnamic acid, 3,4-difluoro-alpha-methylhydrocinnamic acid, 3,4-Difluoro-|A-methylbenzenepropanoic acid, 3-(3,4-difluorophenyl)-2-methyl-propanoic acid