CAS 32022-22-3 is the registry number for (2E)-3-(4-Isopropoxy-3-methoxyphenyl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
(E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoic acid (CAS 32022-22-3) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoic acid. InChIKey: HCIFIHNJOLFAAX-FNORWQNLSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoic acid |
| InChIKey | HCIFIHNJOLFAAX-FNORWQNLSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)/C=C/C(=O)O)OC |
Computed by PubChem (NCBI)