Products 32022-22-3

CAS 32022-22-3 is the registry number for (2E)-3-(4-Isopropoxy-3-methoxyphenyl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.

Structural formula: {0} (CAS {1})

(E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoic acid (CAS 32022-22-3) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoic acid. InChIKey: HCIFIHNJOLFAAX-FNORWQNLSA-N.

Identity
Molecular formulaC13H16O4
Molecular weight236.26 g/mol
IUPAC name(E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoic acid
InChIKeyHCIFIHNJOLFAAX-FNORWQNLSA-N
SMILESCC(C)OC1=C(C=C(C=C1)/C=C/C(=O)O)OC

Computed by PubChem (NCBI)