CAS 32024-15-0 appears in our catalog under these names: 4,5–Dimethoxy–3–iodobenzaldehyde, 3-Iodo-4,5-dimethoxybenzaldehyde 95%, 3-Iodo-4,5-dimethoxybenzaldehyde, 97%, 97%, 3-Iodo-4,5-dimethoxybenzaldehyde, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 250mg, 100g.
3-iodo-4,5-dimethoxybenzaldehyde (CAS 32024-15-0) is a chemical compound with the molecular formula C9H9IO3 and a molecular weight of 292.07 g/mol. IUPAC name: 3-iodo-4,5-dimethoxybenzaldehyde. InChIKey: MVPNBXPAUYYZAF-UHFFFAOYSA-N.
| Molecular formula | C9H9IO3 |
|---|---|
| Molecular weight | 292.07 g/mol |
| IUPAC name | 3-iodo-4,5-dimethoxybenzaldehyde |
| InChIKey | MVPNBXPAUYYZAF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C=O)I)OC |
Computed by PubChem (NCBI)