Products 32039-74-0
CAS 32039-74-0 appears in our catalog under these names: Stachydrinehydrochloride, 97%, 2-CARBOXY-1,1-DIMETHYLPYRROLIDINIUM CHLORIDE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride (CAS 32039-74-0) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: 1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride. InChIKey: DUNMULOWUUIQIL-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | 1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride |
| InChIKey | DUNMULOWUUIQIL-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCCC1C(=O)O)C.[Cl-] |
Computed by PubChem (NCBI)