CAS 320778-96-9 appears in our catalog under these names: (1R,2R)-N1,N1-Dimethyl-1,2-diphenylethane-1,2-diamine, 97+%, (1R，2R)–N'，N'–Dimethyl–1，2–diphenyl–1，2–ethanediamine, (1R,2R)-N1,N1-Dimethyl-1,2-diphenylethane-1,2-diamine, 95%, 95%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 10g, 1g, 250mg, 100mg.
(1R,2R)-N',N'-dimethyl-1,2-diphenylethane-1,2-diamine (CAS 320778-96-9) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: (1R,2R)-N',N'-dimethyl-1,2-diphenylethane-1,2-diamine. InChIKey: OEDXASUOCKHCRL-HZPDHXFCSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | (1R,2R)-N',N'-dimethyl-1,2-diphenylethane-1,2-diamine |
| InChIKey | OEDXASUOCKHCRL-HZPDHXFCSA-N |
| SMILES | CN(C)[C@H](C1=CC=CC=C1)[C@@H](C2=CC=CC=C2)N |
Computed by PubChem (NCBI)