CAS 321318-11-0 appears in our catalog under these names: 1-(3,5-Difluorophenyl)ethan-1-amine hydrochloride, 95%, 1–(3,5–Difluorophenyl)ethanamine hydrochloride, 1-(3,5-Difluorophenyl)ethanamine hydrochloride, 98%, 98%, 1-(3,5-Difluorophenyl)ethanamine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 25g, 2.5g.
1-(3,5-difluorophenyl)ethanamine;hydrochloride (CAS 321318-11-0) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: 1-(3,5-difluorophenyl)ethanamine;hydrochloride. InChIKey: YSKNBJOMVKILCE-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | YSKNBJOMVKILCE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)F)F)N.Cl |
Computed by PubChem (NCBI)