CAS 321318-28-9 appears in our catalog under these names: (R)-1-(3,5-Difluorophenyl)ethanamine hydrochloride, 95%, 95%, (R)-1-(3,5-Difluorophenyl)ethanamine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R)-1-(3,5-difluorophenyl)ethanamine;hydrochloride (CAS 321318-28-9) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: (1R)-1-(3,5-difluorophenyl)ethanamine;hydrochloride. InChIKey: YSKNBJOMVKILCE-NUBCRITNSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | (1R)-1-(3,5-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | YSKNBJOMVKILCE-NUBCRITNSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)F)F)N.Cl |
Computed by PubChem (NCBI)