CAS 321707-21-5 is the registry number for prop-2-ynyl((2,4,6-trimethylphenyl)sulfonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
2,4,6-trimethyl-N-prop-2-ynylbenzenesulfonamide (CAS 321707-21-5) is a chemical compound with the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. IUPAC name: 2,4,6-trimethyl-N-prop-2-ynylbenzenesulfonamide. InChIKey: YRVLJWMXLGKKGJ-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2S |
|---|---|
| Molecular weight | 237.32 g/mol |
| IUPAC name | 2,4,6-trimethyl-N-prop-2-ynylbenzenesulfonamide |
| InChIKey | YRVLJWMXLGKKGJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)NCC#C)C |
Computed by PubChem (NCBI)