CAS 321725-87-5 appears in our catalog under these names: 4-Formyl-2-methoxyphenyl 3-methylbenzoate, 95%, 4-Formyl-2-methoxyphenyl 3-methylbenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(4-formyl-2-methoxyphenyl) 3-methylbenzoate (CAS 321725-87-5) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) 3-methylbenzoate. InChIKey: SDLISEHSQWOELD-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) 3-methylbenzoate |
| InChIKey | SDLISEHSQWOELD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)OC2=C(C=C(C=C2)C=O)OC |
Computed by PubChem (NCBI)