Products 321868-49-9
CAS 321868-49-9 is the registry number for Harzialacton A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S,5S)-5-benzyl-3-hydroxyoxolan-2-one (CAS 321868-49-9) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: (3S,5S)-5-benzyl-3-hydroxyoxolan-2-one. InChIKey: QDWGWZDQSRYLTG-UWVGGRQHSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | (3S,5S)-5-benzyl-3-hydroxyoxolan-2-one |
| InChIKey | QDWGWZDQSRYLTG-UWVGGRQHSA-N |
| SMILES | C1[C@@H](OC(=O)[C@H]1O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)