Products 321979-21-9

CAS 321979-21-9 is the registry number for 4-(3-Trifluoromethyl-phenylsulfamoyl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid (CAS 321979-21-9) is a chemical compound with the molecular formula C14H10F3NO4S and a molecular weight of 345.30 g/mol. IUPAC name: 4-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid. InChIKey: NOPXPKAQTBKIIK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10F3NO4S
Molecular weight345.30 g/mol
IUPAC name4-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid
InChIKeyNOPXPKAQTBKIIK-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)NS(=O)(=O)C2=CC=C(C=C2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)