CAS 926222-83-5 is the registry number for 5-Sulfamoyl-2-(3-(trifluoromethyl)phenyl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-sulfamoyl-2-[3-(trifluoromethyl)phenyl]benzoic acid (CAS 926222-83-5) is a chemical compound with the molecular formula C14H10F3NO4S and a molecular weight of 345.30 g/mol. IUPAC name: 5-sulfamoyl-2-[3-(trifluoromethyl)phenyl]benzoic acid. InChIKey: RAYDPBBVBXFQFG-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO4S |
|---|---|
| Molecular weight | 345.30 g/mol |
| IUPAC name | 5-sulfamoyl-2-[3-(trifluoromethyl)phenyl]benzoic acid |
| InChIKey | RAYDPBBVBXFQFG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=C(C=C(C=C2)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)