CAS 794559-15-2 appears in our catalog under these names: 4-(2,3,4-Trifluorobenzenesulfonamidomethyl)benzoic acid, 95%, 4-(2,3,4-Trifluorobenzenesulfonamidomethyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
4-[[(2,3,4-trifluorophenyl)sulfonylamino]methyl]benzoic acid (CAS 794559-15-2) is a chemical compound with the molecular formula C14H10F3NO4S and a molecular weight of 345.30 g/mol. IUPAC name: 4-[[(2,3,4-trifluorophenyl)sulfonylamino]methyl]benzoic acid. InChIKey: IFCBFZRDWYGXRH-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO4S |
|---|---|
| Molecular weight | 345.30 g/mol |
| IUPAC name | 4-[[(2,3,4-trifluorophenyl)sulfonylamino]methyl]benzoic acid |
| InChIKey | IFCBFZRDWYGXRH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNS(=O)(=O)C2=C(C(=C(C=C2)F)F)F)C(=O)O |
Computed by PubChem (NCBI)