Products 327092-91-1
CAS 327092-91-1 appears in our catalog under these names: 3-(3-Trifluoromethyl-phenylsulfamoyl)-benzoic acid, 95%, 3-{(3-(trifluoromethyl)phenyl)sulfamoyl}benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid (CAS 327092-91-1) is a chemical compound with the molecular formula C14H10F3NO4S and a molecular weight of 345.30 g/mol. IUPAC name: 3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid. InChIKey: MXVNZLMSWKIWPW-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO4S |
|---|---|
| Molecular weight | 345.30 g/mol |
| IUPAC name | 3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid |
| InChIKey | MXVNZLMSWKIWPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NC2=CC=CC(=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)