Products 613657-60-6

CAS 613657-60-6 is the registry number for 3-(3-Trifluoromethylphenylsulfonamido)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid (CAS 613657-60-6) is a chemical compound with the molecular formula C14H10F3NO4S and a molecular weight of 345.30 g/mol. IUPAC name: 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid. InChIKey: LTXNSYUJJVHELV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10F3NO4S
Molecular weight345.30 g/mol
IUPAC name3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid
InChIKeyLTXNSYUJJVHELV-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)NS(=O)(=O)C2=CC=CC(=C2)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)