CAS 32272-23-4 is the registry number for 4′-Hydroxy-7-methoxyflavone. Offered by: TRC. Available pack sizes: 100mg, 25mg.
(E)-3-(2,5-dimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one (CAS 32272-23-4) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: (E)-3-(2,5-dimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one. InChIKey: URPAREMBXBSUFI-VQHVLOKHSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | (E)-3-(2,5-dimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | URPAREMBXBSUFI-VQHVLOKHSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)/C=C/C(=O)C2=CC=CC=C2O |
Computed by PubChem (NCBI)