CAS 32275-63-1 appears in our catalog under these names: 1-Phenyl-4,5,6,7-tetrahydro-1h-indazole-3-carboxylic acid, 95%, 1-Phenyl-4,5,6,7-tetrahydro-1h-indazole-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
1-phenyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid (CAS 32275-63-1) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: 1-phenyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid. InChIKey: RTQVNHMXVLFXIX-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 1-phenyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| InChIKey | RTQVNHMXVLFXIX-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)