CAS 32314-39-9 appears in our catalog under these names: 4-Chloro-2,8-dimethylquinoline, 95%, 4-Chloro-2,8-dimethylquinoline 98%, 4-Chloro-2,8-dimethylquinoline, 98%, 98%, 4-CHLORO-2,8-DIMETHYLQUINOLINE, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg.
4-chloro-2,8-dimethylquinoline (CAS 32314-39-9) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 4-chloro-2,8-dimethylquinoline. InChIKey: ILOAZUIOTZZIBK-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 4-chloro-2,8-dimethylquinoline |
| InChIKey | ILOAZUIOTZZIBK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC(=N2)C)Cl |
Computed by PubChem (NCBI)