CAS 32363-45-4 is the registry number for 4-Chloro-3'-methoxybenzophenone. Offered by: TRC. Available pack sizes: 500mg.
(4-chlorophenyl)-(3-methoxyphenyl)methanone (CAS 32363-45-4) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: (4-chlorophenyl)-(3-methoxyphenyl)methanone. InChIKey: ITRZDZXWSBXUFZ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | (4-chlorophenyl)-(3-methoxyphenyl)methanone |
| InChIKey | ITRZDZXWSBXUFZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)