CAS 32445-89-9 appears in our catalog under these names: 2-Methyl-2-[4-(trifluoromethyl)phenyl]propanoic acid, 98%, 2-Methyl-2-(4-(trifluoromethyl)phenyl)propanoic acid, 98%, 98%, 2-Methyl-2-(4-(trifluoromethyl)phenyl)propanoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
2-methyl-2-[4-(trifluoromethyl)phenyl]propanoic acid (CAS 32445-89-9) is a chemical compound with the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. IUPAC name: 2-methyl-2-[4-(trifluoromethyl)phenyl]propanoic acid. InChIKey: HJQVJNQZQTWNPZ-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O2 |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 2-methyl-2-[4-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | HJQVJNQZQTWNPZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)