CAS 32549-31-8 appears in our catalog under these names: 1-(p-Tolyl)imidazolidine-2,4-dione, 98%, CCT-010354, 99.10%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 10mM/1mL, 5 mg, 25 mg, 10 mg.
1-(4-methylphenyl)imidazolidine-2,4-dione (CAS 32549-31-8) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 1-(4-methylphenyl)imidazolidine-2,4-dione. InChIKey: RFLFIALFVCLGHM-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 1-(4-methylphenyl)imidazolidine-2,4-dione |
| InChIKey | RFLFIALFVCLGHM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2CC(=O)NC2=O |
Computed by PubChem (NCBI)