Products 325683-84-9
CAS 325683-84-9 is the registry number for 1-(alpha-L-Threofuranosyl)thymine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 325683-84-9) is a chemical compound with the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. IUPAC name: 1-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: ILPQVLSHRQDSNB-SHYZEUOFSA-N.
| Molecular formula | C9H12N2O5 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 1-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | ILPQVLSHRQDSNB-SHYZEUOFSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@H](CO2)O)O |
Computed by PubChem (NCBI)