CAS 325687-06-7 appears in our catalog under these names: (S)-B-Amino-3,4-dichlorobenzenepropanol, 95%, (S)-2-amino-3-(3,4-dichlorophenyl)propan-1-ol, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
(2S)-2-amino-3-(3,4-dichlorophenyl)propan-1-ol (CAS 325687-06-7) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: (2S)-2-amino-3-(3,4-dichlorophenyl)propan-1-ol. InChIKey: SDQHHIMPZYXBMS-ZETCQYMHSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | (2S)-2-amino-3-(3,4-dichlorophenyl)propan-1-ol |
| InChIKey | SDQHHIMPZYXBMS-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C=C1C[C@@H](CO)N)Cl)Cl |
Computed by PubChem (NCBI)