CAS 849938-01-8 appears in our catalog under these names: (R)-2-Amino-3-(3,4-dichlorophenyl)propan-1-ol, 98%, (R)-2-Amino-3-(3,4-dichlorophenyl)propan-1-ol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g.
(2R)-2-amino-3-(3,4-dichlorophenyl)propan-1-ol (CAS 849938-01-8) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: (2R)-2-amino-3-(3,4-dichlorophenyl)propan-1-ol. InChIKey: SDQHHIMPZYXBMS-SSDOTTSWSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | (2R)-2-amino-3-(3,4-dichlorophenyl)propan-1-ol |
| InChIKey | SDQHHIMPZYXBMS-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C=C1C[C@H](CO)N)Cl)Cl |
Computed by PubChem (NCBI)