Products 325699-54-5
CAS 325699-54-5 is the registry number for 2-(2-((aminothioxomethyl)amino)-2-aza-1-methylvinyl)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
[1-(1,3-dioxoinden-2-yl)ethylideneamino]thiourea (CAS 325699-54-5) is a chemical compound with the molecular formula C12H11N3O2S and a molecular weight of 261.30 g/mol. IUPAC name: [1-(1,3-dioxoinden-2-yl)ethylideneamino]thiourea. InChIKey: IJXHYMKUQQXMLM-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | [1-(1,3-dioxoinden-2-yl)ethylideneamino]thiourea |
| InChIKey | IJXHYMKUQQXMLM-UHFFFAOYSA-N |
| SMILES | CC(=NNC(=S)N)C1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)