Products 32580-00-0
CAS 32580-00-0 is the registry number for 2,4:3,5-Di-O-benzylidene-aldehydo-D-ribose hydrate. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carbaldehyde (CAS 32580-00-0) is a chemical compound with the molecular formula C19H18O5 and a molecular weight of 326.3 g/mol. IUPAC name: 2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carbaldehyde. InChIKey: FGRMUZCQGRXUEH-UHFFFAOYSA-N.
| Molecular formula | C19H18O5 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carbaldehyde |
| InChIKey | FGRMUZCQGRXUEH-UHFFFAOYSA-N |
| SMILES | C1C2C(C(OC(O2)C3=CC=CC=C3)C=O)OC(O1)C4=CC=CC=C4 |
Computed by PubChem (NCBI)