CAS 326-75-0 appears in our catalog under these names: 2-(4-Chloro-2-fluorophenoxy)acetic acid, 98%, 2-(4-Chloro-2-fluorophenoxy)acetic acid, 2-(4-Chloro-2-fluorophenoxy)acetic acid, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 2,5g, 250mg, 1g.
2-(4-chloro-2-fluorophenoxy)acetic acid (CAS 326-75-0) is a chemical compound with the molecular formula C8H6ClFO3 and a molecular weight of 204.58 g/mol. IUPAC name: 2-(4-chloro-2-fluorophenoxy)acetic acid. InChIKey: IOGSUCYKLVFPEH-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO3 |
|---|---|
| Molecular weight | 204.58 g/mol |
| IUPAC name | 2-(4-chloro-2-fluorophenoxy)acetic acid |
| InChIKey | IOGSUCYKLVFPEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)OCC(=O)O |
Computed by PubChem (NCBI)