CAS 326914-22-1 is the registry number for 3–(3–Bromo–phenylcarbamoyl)–acrylic acid. Offered by: GLPBio. Available pack sizes: 500mg.
(E)-4-(3-bromoanilino)-4-oxobut-2-enoic acid (CAS 326914-22-1) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: (E)-4-(3-bromoanilino)-4-oxobut-2-enoic acid. InChIKey: ACABGZCLDYKQMC-SNAWJCMRSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | (E)-4-(3-bromoanilino)-4-oxobut-2-enoic acid |
| InChIKey | ACABGZCLDYKQMC-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)Br)NC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)