CAS 327051-33-2 appears in our catalog under these names: Methyl 2–amino–2–(3–methoxyphenyl)acetate hydrochloride, Methyl 2-amino-2-(3-methoxyphenyl)acetate hydrochloride, Methyl amino(3-methoxyphenyl)acetate hydrochloride, 95%. Offered by: GLPBio, Biosynth, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 10g, 5g.
Methyl 2-amino-2-(3-methoxyphenyl)acetate;hydrochloride (CAS 327051-33-2) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 2-amino-2-(3-methoxyphenyl)acetate;hydrochloride. InChIKey: LZHGTOZAFSEFFO-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 2-amino-2-(3-methoxyphenyl)acetate;hydrochloride |
| InChIKey | LZHGTOZAFSEFFO-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(C(=O)OC)N.Cl |
Computed by PubChem (NCBI)