CAS 32711-59-4 is the registry number for Methyl 3-hydroxy-4H,5H,6H-cyclopenta(b)thiophene-2-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 3-hydroxy-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate (CAS 32711-59-4) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: methyl 3-hydroxy-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate. InChIKey: ACANMVQHXWYSRD-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | methyl 3-hydroxy-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate |
| InChIKey | ACANMVQHXWYSRD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)CCC2)O |
Computed by PubChem (NCBI)