CAS 32721-11-2 appears in our catalog under these names: alpha-(6-Methoxy-2-naphthyl)lactic Acid, Naproxen Impurity 14, Naproxen Impurity 39. Offered by: TRC, Chemat Brand. Available pack sizes: 1g, on request.
2-hydroxy-2-(6-methoxynaphthalen-2-yl)propanoic acid (CAS 32721-11-2) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: 2-hydroxy-2-(6-methoxynaphthalen-2-yl)propanoic acid. InChIKey: TZSHABFTBBOGRG-UHFFFAOYSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 2-hydroxy-2-(6-methoxynaphthalen-2-yl)propanoic acid |
| InChIKey | TZSHABFTBBOGRG-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)C=C(C=C2)OC)(C(=O)O)O |
Computed by PubChem (NCBI)