Products 327990-62-5
CAS 327990-62-5 is the registry number for 6-Bromo-2,3,4,9-tetrahydro-1H-carbazol-1-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-amine (CAS 327990-62-5) is a chemical compound with the molecular formula C12H13BrN2 and a molecular weight of 265.15 g/mol. IUPAC name: 6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-amine. InChIKey: FLPWBPSIEMPYOY-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2 |
|---|---|
| Molecular weight | 265.15 g/mol |
| IUPAC name | 6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| InChIKey | FLPWBPSIEMPYOY-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C3=C(N2)C=CC(=C3)Br)N |
Computed by PubChem (NCBI)