Products 328028-05-3
CAS 328028-05-3 is the registry number for 2-Chloro-5-(3-chloro-4-methyl-phenylsulfamoyl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-chloro-5-[(3-chloro-4-methylphenyl)sulfamoyl]benzoic acid (CAS 328028-05-3) is a chemical compound with the molecular formula C14H11Cl2NO4S and a molecular weight of 360.2 g/mol. IUPAC name: 2-chloro-5-[(3-chloro-4-methylphenyl)sulfamoyl]benzoic acid. InChIKey: SDCKTRXYNWWKLT-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO4S |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | 2-chloro-5-[(3-chloro-4-methylphenyl)sulfamoyl]benzoic acid |
| InChIKey | SDCKTRXYNWWKLT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)