Products 380341-41-3
CAS 380341-41-3 appears in our catalog under these names: 2,4-Dichloro-5-m-tolylsulfamoyl-benzoic acid, 95%, 2,4-Dichloro-5-((3-methylphenyl)sulfamoyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,4-dichloro-5-[(3-methylphenyl)sulfamoyl]benzoic acid (CAS 380341-41-3) is a chemical compound with the molecular formula C14H11Cl2NO4S and a molecular weight of 360.2 g/mol. IUPAC name: 2,4-dichloro-5-[(3-methylphenyl)sulfamoyl]benzoic acid. InChIKey: SCLMHOXYPVUESX-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO4S |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | 2,4-dichloro-5-[(3-methylphenyl)sulfamoyl]benzoic acid |
| InChIKey | SCLMHOXYPVUESX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NS(=O)(=O)C2=C(C=C(C(=C2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)