Products 532430-58-3

CAS 532430-58-3 is the registry number for N-(3-Chlorophenyl)-n-[(4-chlorophenyl)sulfonyl]glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)acetic acid (CAS 532430-58-3) is a chemical compound with the molecular formula C14H11Cl2NO4S and a molecular weight of 360.2 g/mol. IUPAC name: 2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)acetic acid. InChIKey: YAXXIYMQPVQZRV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11Cl2NO4S
Molecular weight360.2 g/mol
IUPAC name2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)acetic acid
InChIKeyYAXXIYMQPVQZRV-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)N(CC(=O)O)S(=O)(=O)C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)