Products 332419-60-0

CAS 332419-60-0 is the registry number for N-(2,3-Dichlorophenyl)-n-(phenylsulfonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetic acid (CAS 332419-60-0) is a chemical compound with the molecular formula C14H11Cl2NO4S and a molecular weight of 360.2 g/mol. IUPAC name: 2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetic acid. InChIKey: RSYKBWLZHNTQLQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11Cl2NO4S
Molecular weight360.2 g/mol
IUPAC name2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetic acid
InChIKeyRSYKBWLZHNTQLQ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=C(C(=CC=C2)Cl)Cl

Computed by PubChem (NCBI)