CAS 332419-60-0 is the registry number for N-(2,3-Dichlorophenyl)-n-(phenylsulfonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetic acid (CAS 332419-60-0) is a chemical compound with the molecular formula C14H11Cl2NO4S and a molecular weight of 360.2 g/mol. IUPAC name: 2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetic acid. InChIKey: RSYKBWLZHNTQLQ-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO4S |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | 2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetic acid |
| InChIKey | RSYKBWLZHNTQLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)