Products 749896-75-1

CAS 749896-75-1 is the registry number for (4-([(3,4-Dichlorophenyl)sulfonyl]amino)phenyl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.

Structural formula: {0} (CAS {1})

2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]acetic acid (CAS 749896-75-1) is a chemical compound with the molecular formula C14H11Cl2NO4S and a molecular weight of 360.2 g/mol. IUPAC name: 2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]acetic acid. InChIKey: JHDALBMVZPHSDO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11Cl2NO4S
Molecular weight360.2 g/mol
IUPAC name2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]acetic acid
InChIKeyJHDALBMVZPHSDO-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CC(=O)O)NS(=O)(=O)C2=CC(=C(C=C2)Cl)Cl

Computed by PubChem (NCBI)