Products 32862-97-8
CAS 32862-97-8 appears in our catalog under these names: 3-(3-Bromophenyl)-2-propenoic acid, 97% (E), 97% (E), 3-Bromocinnamic acid, 97%, 3-Bromocinnamic acid 97% (E), 3-Bromocinnamic acid, >95% (HPLC), 3–Bromocinnamic acid, predominantly trans. Offered by: Chemat, Fluorochem, Ambeed, TRC, GLPBio. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 1g, 500g, 2,5g.
(E)-3-(3-bromophenyl)prop-2-enoic acid (CAS 32862-97-8) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: (E)-3-(3-bromophenyl)prop-2-enoic acid. InChIKey: YEMUSDCFQUBPAL-SNAWJCMRSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | (E)-3-(3-bromophenyl)prop-2-enoic acid |
| InChIKey | YEMUSDCFQUBPAL-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
M-BROMOCINNAMIC ACID, 3-(3-Bromophenyl)-2-propenoic acid, 2-Propenoic acid, 3-(3-bromophenyl)-, (2E)-3-(3-bromophenyl)prop-2-enoic acid, (2E)-3-(3-Bromophenyl)-2-propenoic acid, 3-Bromocinnamic acid, 3-(3-Bromophenyl)acrylic acid, trans-3-Bromocinnamic acid, Cinnamic acid, m-bromo-, (2E)-3-(3-bromophenyl)acrylic acid