CAS 329222-83-5 is the registry number for 3-((3,5-Dimethylphenoxy)methyl)-4-methoxybenzaldehyde. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-[(3,5-dimethylphenoxy)methyl]-4-methoxybenzaldehyde (CAS 329222-83-5) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 3-[(3,5-dimethylphenoxy)methyl]-4-methoxybenzaldehyde. InChIKey: QFNZCIQKNJFSAA-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 3-[(3,5-dimethylphenoxy)methyl]-4-methoxybenzaldehyde |
| InChIKey | QFNZCIQKNJFSAA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OCC2=C(C=CC(=C2)C=O)OC)C |
Computed by PubChem (NCBI)