Products 32929-74-1

CAS 32929-74-1 is the registry number for Fenoprofen Ethyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(3-phenoxyphenyl)propanoate (CAS 32929-74-1) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: ethyl 2-(3-phenoxyphenyl)propanoate. InChIKey: HQZJBPTUMOZUAY-UHFFFAOYSA-N.

Identity
Molecular formulaC17H18O3
Molecular weight270.32 g/mol
IUPAC nameethyl 2-(3-phenoxyphenyl)propanoate
InChIKeyHQZJBPTUMOZUAY-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)C1=CC(=CC=C1)OC2=CC=CC=C2

Computed by PubChem (NCBI)