Products 329348-61-0
CAS 329348-61-0 is the registry number for 6-Chloro-5-formyl-1,4-dimethyl-2-oxo-1,2-dihydropyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-5-formyl-1,4-dimethyl-2-oxopyridine-3-carbonitrile (CAS 329348-61-0) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 6-chloro-5-formyl-1,4-dimethyl-2-oxopyridine-3-carbonitrile. InChIKey: SIVWIBYTOLEQOZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 6-chloro-5-formyl-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
| InChIKey | SIVWIBYTOLEQOZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C(=C1C=O)Cl)C)C#N |
Computed by PubChem (NCBI)