CAS 3297-64-1 appears in our catalog under these names: 2-Carboxyquinoline 1-oxide 95%, 2-Carboxyquinoline 1-oxide, 98%, 98%, 2-Quinolinecarboxylic acid, 1-oxide, 95%, 2-Carboxyquinoline N-oxide, 95-<97%. Offered by: Ambeed, Chemat, Fluorochem, Hoffman Fine Chemicals. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
1-oxidoquinolin-1-ium-2-carboxylic acid (CAS 3297-64-1) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 1-oxidoquinolin-1-ium-2-carboxylic acid. InChIKey: CAGGDJBSADVXFV-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 1-oxidoquinolin-1-ium-2-carboxylic acid |
| InChIKey | CAGGDJBSADVXFV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=[N+]2[O-])C(=O)O |
Computed by PubChem (NCBI)