Products 329941-45-9
CAS 329941-45-9 is the registry number for N-(4-Bromo-3-methylphenyl)-4-methylbenzene-1-sulfonamide, 90%, 90%. Offered by: Chemat. Available pack sizes: 1g.
N-(4-bromo-3-methylphenyl)-4-methylbenzenesulfonamide (CAS 329941-45-9) is a chemical compound with the molecular formula C14H14BrNO2S and a molecular weight of 340.24 g/mol. IUPAC name: N-(4-bromo-3-methylphenyl)-4-methylbenzenesulfonamide. InChIKey: JBCJJKXKLJJDRD-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO2S |
|---|---|
| Molecular weight | 340.24 g/mol |
| IUPAC name | N-(4-bromo-3-methylphenyl)-4-methylbenzenesulfonamide |
| InChIKey | JBCJJKXKLJJDRD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C=C2)Br)C |
Computed by PubChem (NCBI)