CAS 941294-37-7 is the registry number for 2-Bromo-N-(2,3-dimethylphenyl)benzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 500g, 1g, 100g, 5g.
2-bromo-N-(2,3-dimethylphenyl)benzenesulfonamide (CAS 941294-37-7) is a chemical compound with the molecular formula C14H14BrNO2S and a molecular weight of 340.24 g/mol. IUPAC name: 2-bromo-N-(2,3-dimethylphenyl)benzenesulfonamide. InChIKey: LUAGXHKMNXFILL-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO2S |
|---|---|
| Molecular weight | 340.24 g/mol |
| IUPAC name | 2-bromo-N-(2,3-dimethylphenyl)benzenesulfonamide |
| InChIKey | LUAGXHKMNXFILL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NS(=O)(=O)C2=CC=CC=C2Br)C |
Computed by PubChem (NCBI)