CAS 349404-95-1 is the registry number for 4–Bromo–N–(4–ethylphenyl)benzenesulfonamide. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
4-bromo-N-(4-ethylphenyl)benzenesulfonamide (CAS 349404-95-1) is a chemical compound with the molecular formula C14H14BrNO2S and a molecular weight of 340.24 g/mol. IUPAC name: 4-bromo-N-(4-ethylphenyl)benzenesulfonamide. InChIKey: PYULLXLISVYERN-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO2S |
|---|---|
| Molecular weight | 340.24 g/mol |
| IUPAC name | 4-bromo-N-(4-ethylphenyl)benzenesulfonamide |
| InChIKey | PYULLXLISVYERN-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)