CAS 850429-67-3 is the registry number for N-Benzyl 3-bromo-4-methylbenzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
N-benzyl-3-bromo-4-methylbenzenesulfonamide (CAS 850429-67-3) is a chemical compound with the molecular formula C14H14BrNO2S and a molecular weight of 340.24 g/mol. IUPAC name: N-benzyl-3-bromo-4-methylbenzenesulfonamide. InChIKey: UDIVRJRBNLDWNI-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO2S |
|---|---|
| Molecular weight | 340.24 g/mol |
| IUPAC name | N-benzyl-3-bromo-4-methylbenzenesulfonamide |
| InChIKey | UDIVRJRBNLDWNI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)